C20H33NaO7S — CID 23719076
sodium [1,1-diethoxy-2-(2-octylphenoxy)ethyl] sulfate (PubChem CID 23719076) has the molecular formula C20H33NaO7S and a molecular weight of 440.53 g/mol. Its IUPAC name is sodium [1,1-diethoxy-2-(2-octylphenoxy)ethyl] sulfate.
| Compound Name | sodium [1,1-diethoxy-2-(2-octylphenoxy)ethyl] sulfate |
|---|---|
| PubChem CID | 23719076 |
| Molecular Formula | C20H33NaO7S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | sodium [1,1-diethoxy-2-(2-octylphenoxy)ethyl] sulfate |
| SMILES | CCCCCCCCc1ccccc1OCC(OCC)(OCC)OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H34O7S.Na/c1-4-7-8-9-10-11-14-18-15-12-13-16-19(18)24-17-20(25-5-2,26-6-3)27-28(21,22)23;/h12-13,15-16H,4-11,14,17H2,1-3H3,(H,21,22,23);/q;+1/p-1 |
| InChIKey | XHBUSZZWBRBHBB-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|