C20H34O7S — CID 23028152
[1,1-diethoxy-2-(2-octylphenoxy)ethyl] hydrogen sulfate (PubChem CID 23028152) has the molecular formula C20H34O7S and a molecular weight of 418.55 g/mol. Its IUPAC name is [1,1-diethoxy-2-(2-octylphenoxy)ethyl] hydrogen sulfate.
| Compound Name | [1,1-diethoxy-2-(2-octylphenoxy)ethyl] hydrogen sulfate |
|---|---|
| PubChem CID | 23028152 |
| Molecular Formula | C20H34O7S |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [1,1-diethoxy-2-(2-octylphenoxy)ethyl] hydrogen sulfate |
| SMILES | CCCCCCCCc1ccccc1OCC(OCC)(OCC)OS(=O)(=O)O |
| InChI | InChI=1S/C20H34O7S/c1-4-7-8-9-10-11-14-18-15-12-13-16-19(18)24-17-20(25-5-2,26-6-3)27-28(21,22)23/h12-13,15-16H,4-11,14,17H2,1-3H3,(H,21,22,23) |
| InChIKey | SWWHURWGZXAAPE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|