C15H25NO4S — CID 138544155
(2-nonylphenoxy)sulfamic acid (PubChem CID 138544155) has the molecular formula C15H25NO4S and a molecular weight of 315.43 g/mol. Its IUPAC name is (2-nonylphenoxy)sulfamic acid.
| Compound Name | (2-nonylphenoxy)sulfamic acid |
|---|---|
| PubChem CID | 138544155 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (2-nonylphenoxy)sulfamic acid |
| SMILES | CCCCCCCCCc1ccccc1ONS(=O)(=O)O |
| InChI | InChI=1S/C15H25NO4S/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)20-16-21(17,18)19/h9-10,12-13,16H,2-8,11H2,1H3,(H,17,18,19) |
| InChIKey | XLTOPYNVYIZWML-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|