C22H38O7S2 — CID 123552516
(2,3-dioctylphenyl) sulfo sulfate (PubChem CID 123552516) has the molecular formula C22H38O7S2 and a molecular weight of 478.67 g/mol. Its IUPAC name is (2,3-dioctylphenyl) sulfo sulfate.
| Compound Name | (2,3-dioctylphenyl) sulfo sulfate |
|---|---|
| PubChem CID | 123552516 |
| Molecular Formula | C22H38O7S2 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (2,3-dioctylphenyl) sulfo sulfate |
| SMILES | CCCCCCCCc1cccc(OS(=O)(=O)OS(=O)(=O)O)c1CCCCCCCC |
| InChI | InChI=1S/C22H38O7S2/c1-3-5-7-9-11-13-16-20-17-15-19-22(28-31(26,27)29-30(23,24)25)21(20)18-14-12-10-8-6-4-2/h15,17,19H,3-14,16,18H2,1-2H3,(H,23,24,25) |
| InChIKey | VKGUKTBKWUATLO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|