C24H42O4S — CID 101315619
3-(2,3-diheptylphenoxy)butane-2-sulfonic acid (PubChem CID 101315619) has the molecular formula C24H42O4S and a molecular weight of 426.66 g/mol. Its IUPAC name is 3-(2,3-diheptylphenoxy)butane-2-sulfonic acid.
| Compound Name | 3-(2,3-diheptylphenoxy)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 101315619 |
| Molecular Formula | C24H42O4S |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 3-(2,3-diheptylphenoxy)butane-2-sulfonic acid |
| SMILES | CCCCCCCc1cccc(OC(C)C(C)S(=O)(=O)O)c1CCCCCCC |
| InChI | InChI=1S/C24H42O4S/c1-5-7-9-11-13-16-22-17-15-19-24(23(22)18-14-12-10-8-6-2)28-20(3)21(4)29(25,26)27/h15,17,19-21H,5-14,16,18H2,1-4H3,(H,25,26,27) |
| InChIKey | XDDSDWABTHFBCG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|