3-(2,3-diheptylphenoxy)butane-1-sulfonic acid

C24H42O4S — CID 101315571

IUPAC3-(2,3-diheptylphenoxy)butane-1-sulfonic acid
SMILESCCCCCCCc1cccc(OC(C)CCS(=O)(=O)O)c1CCCCCCC
InChIInChI=1S/C24H42O4S/c1-4-6-8-10-12-15-22-16-14-18-24(23(22)17-13-11-9-7-5-2)28-21(3)19-20-29(25,26)27/h14,16,18,21H,4-13,15,17,19-20H2,1-3H3,(H,25,26,27)
InChIKeyACJYIWSTKGVCPM-UHFFFAOYSA-N
MW426.66 g/mol
LogP6.76
Rot. Bonds17

About 3-(2,3-diheptylphenoxy)butane-1-sulfonic acid

3-(2,3-diheptylphenoxy)butane-1-sulfonic acid (PubChem CID 101315571) has the molecular formula C24H42O4S and a molecular weight of 426.66 g/mol. Its IUPAC name is 3-(2,3-diheptylphenoxy)butane-1-sulfonic acid.

Molecular Properties

Compound Name3-(2,3-diheptylphenoxy)butane-1-sulfonic acid
PubChem CID101315571
Molecular FormulaC24H42O4S
Molecular Weight426.66 g/mol
Exact Mass426.28
IUPAC Name3-(2,3-diheptylphenoxy)butane-1-sulfonic acid
SMILESCCCCCCCc1cccc(OC(C)CCS(=O)(=O)O)c1CCCCCCC
InChIInChI=1S/C24H42O4S/c1-4-6-8-10-12-15-22-16-14-18-24(23(22)17-13-11-9-7-5-2)28-21(3)19-20-29(25,26)27/h14,16,18,21H,4-13,15,17,19-20H2,1-3H3,(H,25,26,27)
InChIKeyACJYIWSTKGVCPM-UHFFFAOYSA-N
XLogP6.76
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds17
Heavy Atoms29
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500426.66
LogP ≤ 56.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-(2,3-diheptylphenoxy)butane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-diheptylphenoxy)butane-1-sulfonic acid?
The IUPAC name of 3-(2,3-diheptylphenoxy)butane-1-sulfonic acid (CID 101315571) is 3-(2,3-diheptylphenoxy)butane-1-sulfonic acid.
What is the SMILES notation for 3-(2,3-diheptylphenoxy)butane-1-sulfonic acid?
The canonical SMILES for 3-(2,3-diheptylphenoxy)butane-1-sulfonic acid is CCCCCCCc1cccc(OC(C)CCS(=O)(=O)O)c1CCCCCCC.
What is the InChIKey of 3-(2,3-diheptylphenoxy)butane-1-sulfonic acid?
The InChIKey is ACJYIWSTKGVCPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O4S/c1-4-6-8-10-12-15-22-16-14-18-24(23(22)17-13-11-9-7-5-2)28-21(3)19-20-29(25,26)27/h14,16,18,21H,4-13,15,17,19-20H2,1-3H3,(H,25,26,27).
What are the key properties of 3-(2,3-diheptylphenoxy)butane-1-sulfonic acid?
3-(2,3-diheptylphenoxy)butane-1-sulfonic acid has a molecular weight of 426.66 g/mol, XLogP of 6.76, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-diheptylphenoxy)butane-1-sulfonic acid is sourced from PubChem (CID 101315571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).