C28H50O4S — CID 101315880
3-[2,5-di(nonyl)phenoxy]butane-1-sulfonic acid (PubChem CID 101315880) has the molecular formula C28H50O4S and a molecular weight of 482.77 g/mol. Its IUPAC name is 3-[2,5-di(nonyl)phenoxy]butane-1-sulfonic acid.
| Compound Name | 3-[2,5-di(nonyl)phenoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 101315880 |
| Molecular Formula | C28H50O4S |
| Molecular Weight | 482.77 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 3-[2,5-di(nonyl)phenoxy]butane-1-sulfonic acid |
| SMILES | CCCCCCCCCc1ccc(CCCCCCCCC)c(OC(C)CCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C28H50O4S/c1-4-6-8-10-12-14-16-18-26-20-21-27(19-17-15-13-11-9-7-5-2)28(24-26)32-25(3)22-23-33(29,30)31/h20-21,24-25H,4-19,22-23H2,1-3H3,(H,29,30,31) |
| InChIKey | IDXMRMWRIHSVMP-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.77 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|