C22H37NaO4S — CID 101315430
sodium 2-(2,5-dihexylphenoxy)butane-1-sulfonate (PubChem CID 101315430) has the molecular formula C22H37NaO4S and a molecular weight of 420.59 g/mol. Its IUPAC name is sodium 2-(2,5-dihexylphenoxy)butane-1-sulfonate.
| Compound Name | sodium 2-(2,5-dihexylphenoxy)butane-1-sulfonate |
|---|---|
| PubChem CID | 101315430 |
| Molecular Formula | C22H37NaO4S |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | sodium 2-(2,5-dihexylphenoxy)butane-1-sulfonate |
| SMILES | CCCCCCc1ccc(CCCCCC)c(OC(CC)CS(=O)(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C22H38O4S.Na/c1-4-7-9-11-13-19-15-16-20(14-12-10-8-5-2)22(17-19)26-21(6-3)18-27(23,24)25;/h15-17,21H,4-14,18H2,1-3H3,(H,23,24,25);/q;+1/p-1 |
| InChIKey | ZMBBYUFBYLKWIQ-UHFFFAOYSA-M |
| XLogP | 2.64 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|