C22H37O2PS2-2 — CID 101318632
1,4-dioctyl-2-[oxido(disulfido)phosphaniumyl]oxybenzene (PubChem CID 101318632) has the molecular formula C22H37O2PS2-2 and a molecular weight of 428.64 g/mol. Its IUPAC name is 1,4-dioctyl-2-[oxido(disulfido)phosphaniumyl]oxybenzene.
| Compound Name | 1,4-dioctyl-2-[oxido(disulfido)phosphaniumyl]oxybenzene |
|---|---|
| PubChem CID | 101318632 |
| Molecular Formula | C22H37O2PS2-2 |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 1,4-dioctyl-2-[oxido(disulfido)phosphaniumyl]oxybenzene |
| SMILES | CCCCCCCCc1ccc(CCCCCCCC)c(O[P+]([O-])([S-])[S-])c1 |
| InChI | InChI=1S/C22H39O2PS2/c1-3-5-7-9-11-13-15-20-17-18-21(16-14-12-10-8-6-4-2)22(19-20)24-25(23,26)27/h17-19H,3-16H2,1-2H3,(H2,23,26,27)/p-2 |
| InChIKey | KGUWAHDHNCKKDU-UHFFFAOYSA-L |
| XLogP | 7.00 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|