C26H45O2PS2Zn — CID 101318677
zinc 1,2-didecyl-4-[oxido(disulfido)phosphaniumyl]oxybenzene (PubChem CID 101318677) has the molecular formula C26H45O2PS2Zn and a molecular weight of 550.14 g/mol. Its IUPAC name is zinc 1,2-didecyl-4-[oxido(disulfido)phosphaniumyl]oxybenzene.
| Compound Name | zinc 1,2-didecyl-4-[oxido(disulfido)phosphaniumyl]oxybenzene |
|---|---|
| PubChem CID | 101318677 |
| Molecular Formula | C26H45O2PS2Zn |
| Molecular Weight | 550.14 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | zinc 1,2-didecyl-4-[oxido(disulfido)phosphaniumyl]oxybenzene |
| SMILES | CCCCCCCCCCc1ccc(O[P+]([O-])([S-])[S-])cc1CCCCCCCCCC.[Zn+2] |
| InChI | InChI=1S/C26H47O2PS2.Zn/c1-3-5-7-9-11-13-15-17-19-24-21-22-26(28-29(27,30)31)23-25(24)20-18-16-14-12-10-8-6-4-2;/h21-23H,3-20H2,1-2H3,(H2,27,30,31);/q;+2/p-2 |
| InChIKey | ATKGHQAGFZFDCI-UHFFFAOYSA-L |
| XLogP | 8.56 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.14 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|