C23H39NaO4S — CID 101315526
sodium 1-(2,5-diheptylphenoxy)propane-1-sulfonate (PubChem CID 101315526) has the molecular formula C23H39NaO4S and a molecular weight of 434.62 g/mol. Its IUPAC name is sodium 1-(2,5-diheptylphenoxy)propane-1-sulfonate.
| Compound Name | sodium 1-(2,5-diheptylphenoxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 101315526 |
| Molecular Formula | C23H39NaO4S |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | sodium 1-(2,5-diheptylphenoxy)propane-1-sulfonate |
| SMILES | CCCCCCCc1ccc(CCCCCCC)c(OC(CC)S(=O)(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C23H40O4S.Na/c1-4-7-9-11-13-15-20-17-18-21(16-14-12-10-8-5-2)22(19-20)27-23(6-3)28(24,25)26;/h17-19,23H,4-16H2,1-3H3,(H,24,25,26);/q;+1/p-1 |
| InChIKey | NQBZFJOGUSGPSO-UHFFFAOYSA-M |
| XLogP | 3.38 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|