C28H49NaO4S — CID 101315926
sodium 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonate (PubChem CID 101315926) has the molecular formula C28H49NaO4S and a molecular weight of 504.75 g/mol. Its IUPAC name is sodium 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonate.
| Compound Name | sodium 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonate |
|---|---|
| PubChem CID | 101315926 |
| Molecular Formula | C28H49NaO4S |
| Molecular Weight | 504.75 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | sodium 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonate |
| SMILES | CCCCCCCCCc1ccc(CCCCCCCCC)c(OC(C)C(C)S(=O)(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C28H50O4S.Na/c1-5-7-9-11-13-15-17-19-26-21-22-27(20-18-16-14-12-10-8-6-2)28(23-26)32-24(3)25(4)33(29,30)31;/h21-25H,5-20H2,1-4H3,(H,29,30,31);/q;+1/p-1 |
| InChIKey | BZKCLCULBYANKU-UHFFFAOYSA-M |
| XLogP | 4.98 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.75 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|