3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid

C28H50O4S — CID 101315927

IUPAC3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid
SMILESCCCCCCCCCc1ccc(CCCCCCCCC)c(OC(C)C(C)S(=O)(=O)O)c1
InChIInChI=1S/C28H50O4S/c1-5-7-9-11-13-15-17-19-26-21-22-27(20-18-16-14-12-10-8-6-2)28(23-26)32-24(3)25(4)33(29,30)31/h21-25H,5-20H2,1-4H3,(H,29,30,31)
InChIKeyYJTMWWUXRUOBBS-UHFFFAOYSA-N
MW482.77 g/mol
LogP8.32
Rot. Bonds20

About 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid

3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid (PubChem CID 101315927) has the molecular formula C28H50O4S and a molecular weight of 482.77 g/mol. Its IUPAC name is 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid.

Molecular Properties

Compound Name3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid
PubChem CID101315927
Molecular FormulaC28H50O4S
Molecular Weight482.77 g/mol
Exact Mass482.34
IUPAC Name3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid
SMILESCCCCCCCCCc1ccc(CCCCCCCCC)c(OC(C)C(C)S(=O)(=O)O)c1
InChIInChI=1S/C28H50O4S/c1-5-7-9-11-13-15-17-19-26-21-22-27(20-18-16-14-12-10-8-6-2)28(23-26)32-24(3)25(4)33(29,30)31/h21-25H,5-20H2,1-4H3,(H,29,30,31)
InChIKeyYJTMWWUXRUOBBS-UHFFFAOYSA-N
XLogP8.32
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds20
Heavy Atoms33
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500482.77
LogP ≤ 58.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

sodium 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonate
CID 101315926
2-(2,5-dipentylphenoxy)butane-1-sulfonic acid
CID 101315275
3-[2,5-di(nonyl)phenoxy]butane-1-sulfonic acid
CID 101315880
1-(2,4-dihexylphenoxy)butane-1-sulfonic acid
CID 101315441
1-(2,4-diheptylphenoxy)propane-1-sulfonic acid
CID 101315525
sodium 1-(2,5-diheptylphenoxy)propane-1-sulfonate
CID 101315526
3-(2,3-diheptylphenoxy)butane-2-sulfonic acid
CID 101315619
2-(2,5-dioctylphenoxy)propane-2-sulfonic acid
CID 101315707
sodium 2-(2,5-dihexylphenoxy)butane-1-sulfonate
CID 101315430
4-(2,5-diheptylphenoxy)butane-1-sulfonic acid
CID 101315563
sodium 2-(2,5-dipentylphenoxy)butane-1-sulfonate
CID 101315274
1,4-dioctyl-2-[oxido(disulfido)phosphaniumyl]oxybenzene
CID 101318632

Frequently Asked Questions

What is the IUPAC name of 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid?
The IUPAC name of 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid (CID 101315927) is 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid.
What is the SMILES notation for 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid?
The canonical SMILES for 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid is CCCCCCCCCc1ccc(CCCCCCCCC)c(OC(C)C(C)S(=O)(=O)O)c1.
What is the InChIKey of 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid?
The InChIKey is YJTMWWUXRUOBBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H50O4S/c1-5-7-9-11-13-15-17-19-26-21-22-27(20-18-16-14-12-10-8-6-2)28(23-26)32-24(3)25(4)33(29,30)31/h21-25H,5-20H2,1-4H3,(H,29,30,31).
What are the key properties of 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid?
3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid has a molecular weight of 482.77 g/mol, XLogP of 8.32, 20 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,5-di(nonyl)phenoxy]butane-2-sulfonic acid is sourced from PubChem (CID 101315927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).