C20H33NaO4S — CID 101315306
sodium 3-(2,3-dipentylphenoxy)butane-2-sulfonate (PubChem CID 101315306) has the molecular formula C20H33NaO4S and a molecular weight of 392.54 g/mol. Its IUPAC name is sodium 3-(2,3-dipentylphenoxy)butane-2-sulfonate.
| Compound Name | sodium 3-(2,3-dipentylphenoxy)butane-2-sulfonate |
|---|---|
| PubChem CID | 101315306 |
| Molecular Formula | C20H33NaO4S |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | sodium 3-(2,3-dipentylphenoxy)butane-2-sulfonate |
| SMILES | CCCCCc1cccc(OC(C)C(C)S(=O)(=O)[O-])c1CCCCC.[Na+] |
| InChI | InChI=1S/C20H34O4S.Na/c1-5-7-9-12-18-13-11-15-20(19(18)14-10-8-6-2)24-16(3)17(4)25(21,22)23;/h11,13,15-17H,5-10,12,14H2,1-4H3,(H,21,22,23);/q;+1/p-1 |
| InChIKey | IPGRTSHBMKSTGE-UHFFFAOYSA-M |
| XLogP | 1.86 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|