C18H29NaO3S — CID 122611048
sodium 2,3-dihexylbenzenesulfonate (PubChem CID 122611048) has the molecular formula C18H29NaO3S and a molecular weight of 348.48 g/mol. Its IUPAC name is sodium 2,3-dihexylbenzenesulfonate.
| Compound Name | sodium 2,3-dihexylbenzenesulfonate |
|---|---|
| PubChem CID | 122611048 |
| Molecular Formula | C18H29NaO3S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | sodium 2,3-dihexylbenzenesulfonate |
| SMILES | CCCCCCc1cccc(S(=O)(=O)[O-])c1CCCCCC.[Na+] |
| InChI | InChI=1S/C18H30O3S.Na/c1-3-5-7-9-12-16-13-11-15-18(22(19,20)21)17(16)14-10-8-6-4-2;/h11,13,15H,3-10,12,14H2,1-2H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | JJAZUBOWZUGMIV-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|