C30H47NaO3S — CID 101324343
sodium 5,6-didecylnaphthalene-1-sulfonate (PubChem CID 101324343) has the molecular formula C30H47NaO3S and a molecular weight of 510.76 g/mol. Its IUPAC name is sodium 5,6-didecylnaphthalene-1-sulfonate.
| Compound Name | sodium 5,6-didecylnaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 101324343 |
| Molecular Formula | C30H47NaO3S |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | sodium 5,6-didecylnaphthalene-1-sulfonate |
| SMILES | CCCCCCCCCCc1ccc2c(S(=O)(=O)[O-])cccc2c1CCCCCCCCCC.[Na+] |
| InChI | InChI=1S/C30H48O3S.Na/c1-3-5-7-9-11-13-15-17-20-26-24-25-29-28(22-19-23-30(29)34(31,32)33)27(26)21-18-16-14-12-10-8-6-4-2;/h19,22-25H,3-18,20-21H2,1-2H3,(H,31,32,33);/q;+1/p-1 |
| InChIKey | QQXKKSLFQSEGKR-UHFFFAOYSA-M |
| XLogP | 6.11 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|