C14H12O5S — CID 101078204
(6-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl) benzenesulfonate (PubChem CID 101078204) has the molecular formula C14H12O5S and a molecular weight of 292.31 g/mol. Its IUPAC name is (6-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl) benzenesulfonate.
| Compound Name | (6-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl) benzenesulfonate |
|---|---|
| PubChem CID | 101078204 |
| Molecular Formula | C14H12O5S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | (6-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl) benzenesulfonate |
| SMILES | COc1ccccc(OS(=O)(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C14H12O5S/c1-18-12-9-5-6-10-13(14(12)15)19-20(16,17)11-7-3-2-4-8-11/h2-10H,1H3 |
| InChIKey | KWRLFFXGEFANLT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|