C15H14O5S — CID 101078205
(6-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl) 4-methylbenzenesulfonate (PubChem CID 101078205) has the molecular formula C15H14O5S and a molecular weight of 306.34 g/mol. Its IUPAC name is (6-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl) 4-methylbenzenesulfonate.
| Compound Name | (6-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101078205 |
| Molecular Formula | C15H14O5S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (6-methoxy-7-oxocyclohepta-1,3,5-trien-1-yl) 4-methylbenzenesulfonate |
| SMILES | COc1ccccc(OS(=O)(=O)c2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C15H14O5S/c1-11-7-9-12(10-8-11)21(17,18)20-14-6-4-3-5-13(19-2)15(14)16/h3-10H,1-2H3 |
| InChIKey | ZHVDMTYJMKGUSE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|