C14H13BrO5S — CID 7574268
(2-bromophenyl) 3,4-dimethoxybenzenesulfonate (PubChem CID 7574268) has the molecular formula C14H13BrO5S and a molecular weight of 373.22 g/mol. Its IUPAC name is (2-bromophenyl) 3,4-dimethoxybenzenesulfonate.
| Compound Name | (2-bromophenyl) 3,4-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 7574268 |
| Molecular Formula | C14H13BrO5S |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | (2-bromophenyl) 3,4-dimethoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2ccccc2Br)cc1OC |
| InChI | InChI=1S/C14H13BrO5S/c1-18-13-8-7-10(9-14(13)19-2)21(16,17)20-12-6-4-3-5-11(12)15/h3-9H,1-2H3 |
| InChIKey | HPPVPKIFNBGLJW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|