About (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate
(2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate (PubChem CID 40604633) has the molecular formula C14H12BrNO4S
and a molecular weight of 370.22 g/mol. Its IUPAC name is (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate |
| PubChem CID | 40604633 |
| Molecular Formula | C14H12BrNO4S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate |
| SMILES | Cc1cc(S(=O)(=O)Oc2ccccc2C(N)=O)ccc1Br |
| InChI | InChI=1S/C14H12BrNO4S/c1-9-8-10(6-7-12(9)15)21(18,19)20-13-5-3-2-4-11(13)14(16)17/h2-8H,1H3,(H2,16,17) |
| InChIKey | JVWQPHFYQDNHCQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate?
The IUPAC name of (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate (CID 40604633) is (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate.
What is the SMILES notation for (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate?
The canonical SMILES for (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate is Cc1cc(S(=O)(=O)Oc2ccccc2C(N)=O)ccc1Br.
What is the InChIKey of (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate?
The InChIKey is JVWQPHFYQDNHCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrNO4S/c1-9-8-10(6-7-12(9)15)21(18,19)20-13-5-3-2-4-11(13)14(16)17/h2-8H,1H3,(H2,16,17).
What are the key properties of (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate?
(2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate has a molecular weight of 370.22 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamoylphenyl) 4-bromo-3-methylbenzenesulfonate is sourced from PubChem (CID 40604633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).