C16H17NO4S — CID 26947585
(2-acetamidophenyl) 3,4-dimethylbenzenesulfonate (PubChem CID 26947585) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is (2-acetamidophenyl) 3,4-dimethylbenzenesulfonate.
| Compound Name | (2-acetamidophenyl) 3,4-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 26947585 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (2-acetamidophenyl) 3,4-dimethylbenzenesulfonate |
| SMILES | CC(=O)Nc1ccccc1OS(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H17NO4S/c1-11-8-9-14(10-12(11)2)22(19,20)21-16-7-5-4-6-15(16)17-13(3)18/h4-10H,1-3H3,(H,17,18) |
| InChIKey | WEFUXAPXUCSSKD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|