C17H19NO5S — CID 37477531
(2-acetamidophenyl) 4-ethoxy-3-methylbenzenesulfonate (PubChem CID 37477531) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is (2-acetamidophenyl) 4-ethoxy-3-methylbenzenesulfonate.
| Compound Name | (2-acetamidophenyl) 4-ethoxy-3-methylbenzenesulfonate |
|---|---|
| PubChem CID | 37477531 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (2-acetamidophenyl) 4-ethoxy-3-methylbenzenesulfonate |
| SMILES | CCOc1ccc(S(=O)(=O)Oc2ccccc2NC(C)=O)cc1C |
| InChI | InChI=1S/C17H19NO5S/c1-4-22-16-10-9-14(11-12(16)2)24(20,21)23-17-8-6-5-7-15(17)18-13(3)19/h5-11H,4H2,1-3H3,(H,18,19) |
| InChIKey | MHYLUNZUEUKIFL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|