About (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate
(2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate (PubChem CID 39845763) has the molecular formula C15H14FNO4S
and a molecular weight of 323.35 g/mol. Its IUPAC name is (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate |
| PubChem CID | 39845763 |
| Molecular Formula | C15H14FNO4S |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate |
| SMILES | CC(=O)Nc1ccccc1OS(=O)(=O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C15H14FNO4S/c1-10-9-12(7-8-13(10)16)22(19,20)21-15-6-4-3-5-14(15)17-11(2)18/h3-9H,1-2H3,(H,17,18) |
| InChIKey | AORUGRGBNYZKIO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate?
The IUPAC name of (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate (CID 39845763) is (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate.
What is the SMILES notation for (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate?
The canonical SMILES for (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate is CC(=O)Nc1ccccc1OS(=O)(=O)c1ccc(F)c(C)c1.
What is the InChIKey of (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate?
The InChIKey is AORUGRGBNYZKIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FNO4S/c1-10-9-12(7-8-13(10)16)22(19,20)21-15-6-4-3-5-14(15)17-11(2)18/h3-9H,1-2H3,(H,17,18).
What are the key properties of (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate?
(2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate has a molecular weight of 323.35 g/mol, XLogP of 2.86, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamidophenyl) 4-fluoro-3-methylbenzenesulfonate is sourced from PubChem (CID 39845763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).