About (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate
(2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate (PubChem CID 7938070) has the molecular formula C15H12F3NO4S
and a molecular weight of 359.33 g/mol. Its IUPAC name is (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 7938070 |
| Molecular Formula | C15H12F3NO4S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(=O)Nc1ccccc1OS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H12F3NO4S/c1-10(20)19-12-7-3-4-8-13(12)23-24(21,22)14-9-5-2-6-11(14)15(16,17)18/h2-9H,1H3,(H,19,20) |
| InChIKey | ZWPNSQPCSORCRG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate?
The IUPAC name of (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate (CID 7938070) is (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate is CC(=O)Nc1ccccc1OS(=O)(=O)c1ccccc1C(F)(F)F.
What is the InChIKey of (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate?
The InChIKey is ZWPNSQPCSORCRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F3NO4S/c1-10(20)19-12-7-3-4-8-13(12)23-24(21,22)14-9-5-2-6-11(14)15(16,17)18/h2-9H,1H3,(H,19,20).
What are the key properties of (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate?
(2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate has a molecular weight of 359.33 g/mol, XLogP of 3.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamidophenyl) 2-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 7938070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).