C17H17F3O4S — CID 22593433
[4-[(2-methylpropan-2-yl)oxy]phenyl] 2-(trifluoromethyl)benzenesulfonate (PubChem CID 22593433) has the molecular formula C17H17F3O4S and a molecular weight of 374.38 g/mol. Its IUPAC name is [4-[(2-methylpropan-2-yl)oxy]phenyl] 2-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[(2-methylpropan-2-yl)oxy]phenyl] 2-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22593433 |
| Molecular Formula | C17H17F3O4S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [4-[(2-methylpropan-2-yl)oxy]phenyl] 2-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)Oc1ccc(OS(=O)(=O)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3O4S/c1-16(2,3)23-12-8-10-13(11-9-12)24-25(21,22)15-7-5-4-6-14(15)17(18,19)20/h4-11H,1-3H3 |
| InChIKey | NQHFXQKIRKDFOV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|