C26H24F9O4S2+ — CID 22593408
diphenylsulfanium;[4-[(2-methylpropan-2-yl)oxy]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 22593408) has the molecular formula C26H24F9O4S2+ and a molecular weight of 635.59 g/mol. Its IUPAC name is diphenylsulfanium;[4-[(2-methylpropan-2-yl)oxy]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | diphenylsulfanium;[4-[(2-methylpropan-2-yl)oxy]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 22593408 |
| Molecular Formula | C26H24F9O4S2+ |
| Molecular Weight | 635.59 g/mol |
| Exact Mass | 635.10 |
| IUPAC Name | diphenylsulfanium;[4-[(2-methylpropan-2-yl)oxy]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CC(C)(C)Oc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1.c1ccc([SH+]c2ccccc2)cc1 |
| InChI | InChI=1S/C14H13F9O4S.C12H10S/c1-10(2,3)26-8-4-6-9(7-5-8)27-28(24,25)14(22,23)12(17,18)11(15,16)13(19,20)21;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h4-7H,1-3H3;1-10H/p+1 |
| InChIKey | OKRLFDBBSRIWNG-UHFFFAOYSA-O |
| XLogP | 7.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.59 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|