About diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate
diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate (PubChem CID 159945623) has the molecular formula C20H15F6O3S2+
and a molecular weight of 481.46 g/mol. Its IUPAC name is diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 159945623 |
| Molecular Formula | C20H15F6O3S2+ |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C(F)(F)F)cc1)C(F)(F)F.c1ccc([SH+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C8H4F6O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;9-7(10,11)5-1-3-6(4-2-5)17-18(15,16)8(12,13)14/h1-10H;1-4H/p+1 |
| InChIKey | OBLHLLJWYXPXLT-UHFFFAOYSA-O |
| XLogP | 5.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate?
The IUPAC name of diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate (CID 159945623) is diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate is O=S(=O)(Oc1ccc(C(F)(F)F)cc1)C(F)(F)F.c1ccc([SH+]c2ccccc2)cc1.
What is the InChIKey of diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate?
The InChIKey is OBLHLLJWYXPXLT-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H10S.C8H4F6O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;9-7(10,11)5-1-3-6(4-2-5)17-18(15,16)8(12,13)14/h1-10H;1-4H/p+1.
What are the key properties of diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate?
diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate has a molecular weight of 481.46 g/mol, XLogP of 5.85, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylsulfanium;[4-(trifluoromethyl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 159945623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).