About diphenylsulfanium;trifluoromethanesulfonate
diphenylsulfanium;trifluoromethanesulfonate (PubChem CID 22247522) has the molecular formula C13H11F3O3S2
and a molecular weight of 336.36 g/mol. Its IUPAC name is diphenylsulfanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | diphenylsulfanium;trifluoromethanesulfonate |
| PubChem CID | 22247522 |
| Molecular Formula | C13H11F3O3S2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | diphenylsulfanium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc([SH+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.CHF3O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3,4)8(5,6)7/h1-10H;(H,5,6,7) |
| InChIKey | VBOGDLCGFBSZKS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze diphenylsulfanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylsulfanium;trifluoromethanesulfonate?
The IUPAC name of diphenylsulfanium;trifluoromethanesulfonate (CID 22247522) is diphenylsulfanium;trifluoromethanesulfonate.
What is the SMILES notation for diphenylsulfanium;trifluoromethanesulfonate?
The canonical SMILES for diphenylsulfanium;trifluoromethanesulfonate is O=S(=O)([O-])C(F)(F)F.c1ccc([SH+]c2ccccc2)cc1.
What is the InChIKey of diphenylsulfanium;trifluoromethanesulfonate?
The InChIKey is VBOGDLCGFBSZKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.CHF3O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3,4)8(5,6)7/h1-10H;(H,5,6,7).
What are the key properties of diphenylsulfanium;trifluoromethanesulfonate?
diphenylsulfanium;trifluoromethanesulfonate has a molecular weight of 336.36 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylsulfanium;trifluoromethanesulfonate is sourced from PubChem (CID 22247522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).