C19H15F3O3S2 — CID 22593435
diphenylsulfanium;2-(trifluoromethyl)benzenesulfonate (PubChem CID 22593435) has the molecular formula C19H15F3O3S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is diphenylsulfanium;2-(trifluoromethyl)benzenesulfonate.
| Compound Name | diphenylsulfanium;2-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22593435 |
| Molecular Formula | C19H15F3O3S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | diphenylsulfanium;2-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccccc1C(F)(F)F.c1ccc([SH+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C7H5F3O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h1-10H;1-4H,(H,11,12,13) |
| InChIKey | WOAFHQRGZNGTNW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|