C13H9Cl2F3O4S2 — CID 174560871
1-(benzenesulfonyl)-2-(trifluoromethyl)benzene;sulfuryl dichloride (PubChem CID 174560871) has the molecular formula C13H9Cl2F3O4S2 and a molecular weight of 421.25 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-(trifluoromethyl)benzene;sulfuryl dichloride.
| Compound Name | 1-(benzenesulfonyl)-2-(trifluoromethyl)benzene;sulfuryl dichloride |
|---|---|
| PubChem CID | 174560871 |
| Molecular Formula | C13H9Cl2F3O4S2 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 419.93 |
| IUPAC Name | 1-(benzenesulfonyl)-2-(trifluoromethyl)benzene;sulfuryl dichloride |
| SMILES | O=S(=O)(Cl)Cl.O=S(=O)(c1ccccc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H9F3O2S.Cl2O2S/c14-13(15,16)11-8-4-5-9-12(11)19(17,18)10-6-2-1-3-7-10;1-5(2,3)4/h1-9H; |
| InChIKey | MPVCWJRCPLGTSM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |