C50H36F6O14S7 — CID 22630658
1,2-bis(benzenesulfonyl)-3-[2,3-bis(benzenesulfonyl)phenyl]sulfanylbenzene;bis(2-(trifluoromethyl)benzenesulfonic acid) (PubChem CID 22630658) has the molecular formula C50H36F6O14S7 and a molecular weight of 1199.28 g/mol. Its IUPAC name is 1,2-bis(benzenesulfonyl)-3-[2,3-bis(benzenesulfonyl)phenyl]sulfanylbenzene;bis(2-(trifluoromethyl)benzenesulfonic acid).
| Compound Name | 1,2-bis(benzenesulfonyl)-3-[2,3-bis(benzenesulfonyl)phenyl]sulfanylbenzene;bis(2-(trifluoromethyl)benzenesulfonic acid) |
|---|---|
| PubChem CID | 22630658 |
| Molecular Formula | C50H36F6O14S7 |
| Molecular Weight | 1199.28 g/mol |
| Exact Mass | 1198.01 |
| IUPAC Name | 1,2-bis(benzenesulfonyl)-3-[2,3-bis(benzenesulfonyl)phenyl]sulfanylbenzene;bis(2-(trifluoromethyl)benzenesulfonic acid) |
| SMILES | O=S(=O)(O)c1ccccc1C(F)(F)F.O=S(=O)(O)c1ccccc1C(F)(F)F.O=S(=O)(c1ccccc1)c1cccc(Sc2cccc(S(=O)(=O)c3ccccc3)c2S(=O)(=O)c2ccccc2)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H26O8S5.2C7H5F3O3S/c37-46(38,27-15-5-1-6-16-27)33-25-13-23-31(35(33)48(41,42)29-19-9-3-10-20-29)45-32-24-14-26-34(47(39,40)28-17-7-2-8-18-28)36(32)49(43,44)30-21-11-4-12-22-30;2*8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h1-26H;2*1-4H,(H,11,12,13) |
| InChIKey | GLDBQOKAQWFIMT-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 245.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1199.28 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|