C21H13F3O5S — CID 175120029
anthracene-9,10-dione;2-(trifluoromethyl)benzenesulfonic acid (PubChem CID 175120029) has the molecular formula C21H13F3O5S and a molecular weight of 434.39 g/mol. Its IUPAC name is anthracene-9,10-dione;2-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | anthracene-9,10-dione;2-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 175120029 |
| Molecular Formula | C21H13F3O5S |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | anthracene-9,10-dione;2-(trifluoromethyl)benzenesulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)c2ccccc21.O=S(=O)(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H8O2.C7H5F3O3S/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h1-8H;1-4H,(H,11,12,13) |
| InChIKey | KBGKDKZHWSVPPE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|