C20H16F3IO4S — CID 173141796
1-iodo-2-(4-methoxyphenyl)benzene;2-(trifluoromethyl)benzenesulfonic acid (PubChem CID 173141796) has the molecular formula C20H16F3IO4S and a molecular weight of 536.31 g/mol. Its IUPAC name is 1-iodo-2-(4-methoxyphenyl)benzene;2-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 1-iodo-2-(4-methoxyphenyl)benzene;2-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 173141796 |
| Molecular Formula | C20H16F3IO4S |
| Molecular Weight | 536.31 g/mol |
| Exact Mass | 535.98 |
| IUPAC Name | 1-iodo-2-(4-methoxyphenyl)benzene;2-(trifluoromethyl)benzenesulfonic acid |
| SMILES | COc1ccc(-c2ccccc2I)cc1.O=S(=O)(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H11IO.C7H5F3O3S/c1-15-11-8-6-10(7-9-11)12-4-2-3-5-13(12)14;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h2-9H,1H3;1-4H,(H,11,12,13) |
| InChIKey | XUTYLTMOASHFKN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.31 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|