C34H27F6IO7S3 — CID 173141243
[4-[4-(2-iodophenyl)phenoxy]phenyl]-bis(4-methylphenyl)sulfanium;trifluoromethanesulfonate;trifluoromethanesulfonic acid (PubChem CID 173141243) has the molecular formula C34H27F6IO7S3 and a molecular weight of 884.68 g/mol. Its IUPAC name is [4-[4-(2-iodophenyl)phenoxy]phenyl]-bis(4-methylphenyl)sulfanium;trifluoromethanesulfonate;trifluoromethanesulfonic acid.
| Compound Name | [4-[4-(2-iodophenyl)phenoxy]phenyl]-bis(4-methylphenyl)sulfanium;trifluoromethanesulfonate;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 173141243 |
| Molecular Formula | C34H27F6IO7S3 |
| Molecular Weight | 884.68 g/mol |
| Exact Mass | 883.99 |
| IUPAC Name | [4-[4-(2-iodophenyl)phenoxy]phenyl]-bis(4-methylphenyl)sulfanium;trifluoromethanesulfonate;trifluoromethanesulfonic acid |
| SMILES | Cc1ccc([S+](c2ccc(C)cc2)c2ccc(Oc3ccc(-c4ccccc4I)cc3)cc2)cc1.O=S(=O)(O)C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C32H26IOS.2CHF3O3S/c1-23-7-17-28(18-8-23)35(29-19-9-24(2)10-20-29)30-21-15-27(16-22-30)34-26-13-11-25(12-14-26)31-5-3-4-6-32(31)33;2*2-1(3,4)8(5,6)7/h3-22H,1-2H3;2*(H,5,6,7)/q+1;;/p-1 |
| InChIKey | RGOSJVVGXLFIBI-UHFFFAOYSA-M |
| XLogP | 9.91 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.68 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|