C31H25Cl2IO9S — CID 173141234
CID 173141234 (PubChem CID 173141234) has the molecular formula C31H25Cl2IO9S and a molecular weight of 771.41 g/mol.
| Compound Name | CID 173141234 |
|---|---|
| PubChem CID | 173141234 |
| Molecular Formula | C31H25Cl2IO9S |
| Molecular Weight | 771.41 g/mol |
| Exact Mass | 769.96 |
| IUPAC Name | — |
| SMILES | Cc1ccc(I)c(-c2ccc(Oc3ccc([S+](c4ccccc4)c4ccccc4)cc3)cc2)c1.[O-][Cl+3]([O-])([O-])O.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C31H24IOS.2ClHO4/c1-23-12-21-31(32)30(22-23)24-13-15-25(16-14-24)33-26-17-19-29(20-18-26)34(27-8-4-2-5-9-27)28-10-6-3-7-11-28;2*2-1(3,4)5/h2-22H,1H3;2*(H,2,3,4,5)/q+1;;/p-1 |
| InChIKey | ZBUCCDLQJXUSAH-UHFFFAOYSA-M |
| XLogP | 0.27 |
| TPSA | 190.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.41 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|