C31H25O4S+ — CID 162474039
bis[4-(4-hydroxyphenoxy)phenyl]-(4-methylphenyl)sulfanium (PubChem CID 162474039) has the molecular formula C31H25O4S+ and a molecular weight of 493.60 g/mol. Its IUPAC name is bis[4-(4-hydroxyphenoxy)phenyl]-(4-methylphenyl)sulfanium.
| Compound Name | bis[4-(4-hydroxyphenoxy)phenyl]-(4-methylphenyl)sulfanium |
|---|---|
| PubChem CID | 162474039 |
| Molecular Formula | C31H25O4S+ |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | bis[4-(4-hydroxyphenoxy)phenyl]-(4-methylphenyl)sulfanium |
| SMILES | Cc1ccc([S+](c2ccc(Oc3ccc(O)cc3)cc2)c2ccc(Oc3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H24O4S/c1-22-2-16-29(17-3-22)36(30-18-12-27(13-19-30)34-25-8-4-23(32)5-9-25)31-20-14-28(15-21-31)35-26-10-6-24(33)7-11-26/h2-21H,1H3,(H-,32,33)/p+1 |
| InChIKey | LMEBPMUEMSDKFS-UHFFFAOYSA-O |
| XLogP | 8.09 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|