C40H37O4S+ — CID 145450993
bis(4-hydroxyphenyl)-[4-[[4-[2-(4-hydroxyphenyl)ethyl]phenyl]methyl]phenyl]sulfanium;4-methylphenol (PubChem CID 145450993) has the molecular formula C40H37O4S+ and a molecular weight of 613.80 g/mol. Its IUPAC name is bis(4-hydroxyphenyl)-[4-[[4-[2-(4-hydroxyphenyl)ethyl]phenyl]methyl]phenyl]sulfanium;4-methylphenol.
| Compound Name | bis(4-hydroxyphenyl)-[4-[[4-[2-(4-hydroxyphenyl)ethyl]phenyl]methyl]phenyl]sulfanium;4-methylphenol |
|---|---|
| PubChem CID | 145450993 |
| Molecular Formula | C40H37O4S+ |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | bis(4-hydroxyphenyl)-[4-[[4-[2-(4-hydroxyphenyl)ethyl]phenyl]methyl]phenyl]sulfanium;4-methylphenol |
| SMILES | Cc1ccc(O)cc1.Oc1ccc(CCc2ccc(Cc3ccc([S+](c4ccc(O)cc4)c4ccc(O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H28O3S.C7H8O/c34-28-11-7-25(8-12-28)2-1-24-3-5-26(6-4-24)23-27-9-17-31(18-10-27)37(32-19-13-29(35)14-20-32)33-21-15-30(36)16-22-33;1-6-2-4-7(8)5-3-6/h3-22H,1-2,23H2,(H2-,34,35,36);2-5,8H,1H3/p+1 |
| InChIKey | CRAWJEZMYZHRQZ-UHFFFAOYSA-O |
| XLogP | 8.98 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|