About 4-methylphenol;hydrate
4-methylphenol;hydrate (PubChem CID 71777661) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 4-methylphenol;hydrate.
Molecular Properties
| Compound Name | 4-methylphenol;hydrate |
| PubChem CID | 71777661 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 4-methylphenol;hydrate |
| SMILES | Cc1ccc(O)cc1.O |
| InChI | InChI=1S/C7H8O.H2O/c1-6-2-4-7(8)5-3-6;/h2-5,8H,1H3;1H2 |
| InChIKey | ZDBPCZHKDJAVSB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylphenol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol;hydrate?
The IUPAC name of 4-methylphenol;hydrate (CID 71777661) is 4-methylphenol;hydrate.
What is the SMILES notation for 4-methylphenol;hydrate?
The canonical SMILES for 4-methylphenol;hydrate is Cc1ccc(O)cc1.O.
What is the InChIKey of 4-methylphenol;hydrate?
The InChIKey is ZDBPCZHKDJAVSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.H2O/c1-6-2-4-7(8)5-3-6;/h2-5,8H,1H3;1H2.
What are the key properties of 4-methylphenol;hydrate?
4-methylphenol;hydrate has a molecular weight of 126.15 g/mol, XLogP of 0.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol;hydrate is sourced from PubChem (CID 71777661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).