About ethane;formic acid;4-methylphenol
ethane;formic acid;4-methylphenol (PubChem CID 143673297) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is ethane;formic acid;4-methylphenol.
Molecular Properties
| Compound Name | ethane;formic acid;4-methylphenol |
| PubChem CID | 143673297 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | ethane;formic acid;4-methylphenol |
| SMILES | CC.Cc1ccc(O)cc1.O=CO |
| InChI | InChI=1S/C7H8O.C2H6.CH2O2/c1-6-2-4-7(8)5-3-6;1-2;2-1-3/h2-5,8H,1H3;1-2H3;1H,(H,2,3) |
| InChIKey | HEQYHBOOWKZRHO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;formic acid;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formic acid;4-methylphenol?
The IUPAC name of ethane;formic acid;4-methylphenol (CID 143673297) is ethane;formic acid;4-methylphenol.
What is the SMILES notation for ethane;formic acid;4-methylphenol?
The canonical SMILES for ethane;formic acid;4-methylphenol is CC.Cc1ccc(O)cc1.O=CO.
What is the InChIKey of ethane;formic acid;4-methylphenol?
The InChIKey is HEQYHBOOWKZRHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C2H6.CH2O2/c1-6-2-4-7(8)5-3-6;1-2;2-1-3/h2-5,8H,1H3;1-2H3;1H,(H,2,3).
What are the key properties of ethane;formic acid;4-methylphenol?
ethane;formic acid;4-methylphenol has a molecular weight of 184.23 g/mol, XLogP of 2.43, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formic acid;4-methylphenol is sourced from PubChem (CID 143673297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).