1-chloro-4-methylbenzene;formic acid

C8H9ClO2 — CID 158103199

IUPAC1-chloro-4-methylbenzene;formic acid
SMILESCc1ccc(Cl)cc1.O=CO
InChIInChI=1S/C7H7Cl.CH2O2/c1-6-2-4-7(8)5-3-6;2-1-3/h2-5H,1H3;1H,(H,2,3)
InChIKeyFPNCLHKXGYISFV-UHFFFAOYSA-N
MW172.61 g/mol
LogP2.35
Rot. Bonds

About 1-chloro-4-methylbenzene;formic acid

1-chloro-4-methylbenzene;formic acid (PubChem CID 158103199) has the molecular formula C8H9ClO2 and a molecular weight of 172.61 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;formic acid.

Molecular Properties

Compound Name1-chloro-4-methylbenzene;formic acid
PubChem CID158103199
Molecular FormulaC8H9ClO2
Molecular Weight172.61 g/mol
Exact Mass172.03
IUPAC Name1-chloro-4-methylbenzene;formic acid
SMILESCc1ccc(Cl)cc1.O=CO
InChIInChI=1S/C7H7Cl.CH2O2/c1-6-2-4-7(8)5-3-6;2-1-3/h2-5H,1H3;1H,(H,2,3)
InChIKeyFPNCLHKXGYISFV-UHFFFAOYSA-N
XLogP2.35
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.61
LogP ≤ 52.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 1-chloro-4-methylbenzene;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-chloro-4-methylbenzene;formic acid?
The IUPAC name of 1-chloro-4-methylbenzene;formic acid (CID 158103199) is 1-chloro-4-methylbenzene;formic acid.
What is the SMILES notation for 1-chloro-4-methylbenzene;formic acid?
The canonical SMILES for 1-chloro-4-methylbenzene;formic acid is Cc1ccc(Cl)cc1.O=CO.
What is the InChIKey of 1-chloro-4-methylbenzene;formic acid?
The InChIKey is FPNCLHKXGYISFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl.CH2O2/c1-6-2-4-7(8)5-3-6;2-1-3/h2-5H,1H3;1H,(H,2,3).
What are the key properties of 1-chloro-4-methylbenzene;formic acid?
1-chloro-4-methylbenzene;formic acid has a molecular weight of 172.61 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-methylbenzene;formic acid is sourced from PubChem (CID 158103199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).