About 1-chloro-4-methylbenzene;formic acid
1-chloro-4-methylbenzene;formic acid (PubChem CID 158103199) has the molecular formula C8H9ClO2
and a molecular weight of 172.61 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;formic acid.
Molecular Properties
| Compound Name | 1-chloro-4-methylbenzene;formic acid |
| PubChem CID | 158103199 |
| Molecular Formula | C8H9ClO2 |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 1-chloro-4-methylbenzene;formic acid |
| SMILES | Cc1ccc(Cl)cc1.O=CO |
| InChI | InChI=1S/C7H7Cl.CH2O2/c1-6-2-4-7(8)5-3-6;2-1-3/h2-5H,1H3;1H,(H,2,3) |
| InChIKey | FPNCLHKXGYISFV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-methylbenzene;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-methylbenzene;formic acid?
The IUPAC name of 1-chloro-4-methylbenzene;formic acid (CID 158103199) is 1-chloro-4-methylbenzene;formic acid.
What is the SMILES notation for 1-chloro-4-methylbenzene;formic acid?
The canonical SMILES for 1-chloro-4-methylbenzene;formic acid is Cc1ccc(Cl)cc1.O=CO.
What is the InChIKey of 1-chloro-4-methylbenzene;formic acid?
The InChIKey is FPNCLHKXGYISFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl.CH2O2/c1-6-2-4-7(8)5-3-6;2-1-3/h2-5H,1H3;1H,(H,2,3).
What are the key properties of 1-chloro-4-methylbenzene;formic acid?
1-chloro-4-methylbenzene;formic acid has a molecular weight of 172.61 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-methylbenzene;formic acid is sourced from PubChem (CID 158103199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).