About 1-chloro-4-methylbenzene;zinc
1-chloro-4-methylbenzene;zinc (PubChem CID 174694335) has the molecular formula C7H7ClZn
and a molecular weight of 191.98 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;zinc.
Molecular Properties
| Compound Name | 1-chloro-4-methylbenzene;zinc |
| PubChem CID | 174694335 |
| Molecular Formula | C7H7ClZn |
| Molecular Weight | 191.98 g/mol |
| Exact Mass | 189.95 |
| IUPAC Name | 1-chloro-4-methylbenzene;zinc |
| SMILES | Cc1ccc(Cl)cc1.[Zn] |
| InChI | InChI=1S/C7H7Cl.Zn/c1-6-2-4-7(8)5-3-6;/h2-5H,1H3; |
| InChIKey | BMOKWFHZRLYKJZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.98 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-methylbenzene;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-methylbenzene;zinc?
The IUPAC name of 1-chloro-4-methylbenzene;zinc (CID 174694335) is 1-chloro-4-methylbenzene;zinc.
What is the SMILES notation for 1-chloro-4-methylbenzene;zinc?
The canonical SMILES for 1-chloro-4-methylbenzene;zinc is Cc1ccc(Cl)cc1.[Zn].
What is the InChIKey of 1-chloro-4-methylbenzene;zinc?
The InChIKey is BMOKWFHZRLYKJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl.Zn/c1-6-2-4-7(8)5-3-6;/h2-5H,1H3;.
What are the key properties of 1-chloro-4-methylbenzene;zinc?
1-chloro-4-methylbenzene;zinc has a molecular weight of 191.98 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-methylbenzene;zinc is sourced from PubChem (CID 174694335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).