C13H10Cl4 — CID 90450640
1-chloro-4-methylbenzene;1,2,4-trichlorobenzene (PubChem CID 90450640) has the molecular formula C13H10Cl4 and a molecular weight of 308.04 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;1,2,4-trichlorobenzene.
| Compound Name | 1-chloro-4-methylbenzene;1,2,4-trichlorobenzene |
|---|---|
| PubChem CID | 90450640 |
| Molecular Formula | C13H10Cl4 |
| Molecular Weight | 308.04 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | 1-chloro-4-methylbenzene;1,2,4-trichlorobenzene |
| SMILES | Cc1ccc(Cl)cc1.Clc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H7Cl.C6H3Cl3/c1-6-2-4-7(8)5-3-6;7-4-1-2-5(8)6(9)3-4/h2-5H,1H3;1-3H |
| InChIKey | ZBCRDSLRHWYRMC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.04 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|