C6H4Cl3Na — CID 173452443
sodium;hydride;1,2,4-trichlorobenzene (PubChem CID 173452443) has the molecular formula C6H4Cl3Na and a molecular weight of 205.45 g/mol. Its IUPAC name is sodium;hydride;1,2,4-trichlorobenzene.
| Compound Name | sodium;hydride;1,2,4-trichlorobenzene |
|---|---|
| PubChem CID | 173452443 |
| Molecular Formula | C6H4Cl3Na |
| Molecular Weight | 205.45 g/mol |
| Exact Mass | 203.93 |
| IUPAC Name | sodium;hydride;1,2,4-trichlorobenzene |
| SMILES | Clc1ccc(Cl)c(Cl)c1.[H-].[Na+] |
| InChI | InChI=1S/C6H3Cl3.Na.H/c7-4-1-2-5(8)6(9)3-4;;/h1-3H;;/q;+1;-1 |
| InChIKey | YBQAJVHXINZLCT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|