C12H7Cl5 — CID 161216251
1,2-dichlorobenzene;1,2,4-trichlorobenzene (PubChem CID 161216251) has the molecular formula C12H7Cl5 and a molecular weight of 328.45 g/mol. Its IUPAC name is 1,2-dichlorobenzene;1,2,4-trichlorobenzene.
| Compound Name | 1,2-dichlorobenzene;1,2,4-trichlorobenzene |
|---|---|
| PubChem CID | 161216251 |
| Molecular Formula | C12H7Cl5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 325.90 |
| IUPAC Name | 1,2-dichlorobenzene;1,2,4-trichlorobenzene |
| SMILES | Clc1ccc(Cl)c(Cl)c1.Clc1ccccc1Cl |
| InChI | InChI=1S/C6H3Cl3.C6H4Cl2/c7-4-1-2-5(8)6(9)3-4;7-5-3-1-2-4-6(5)8/h1-3H;1-4H |
| InChIKey | UWXDCLDVKQQUKF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|