C6H5Cl4O4P — CID 68982489
chloro dihydrogen phosphate;1,2,4-trichlorobenzene (PubChem CID 68982489) has the molecular formula C6H5Cl4O4P and a molecular weight of 313.89 g/mol. Its IUPAC name is chloro dihydrogen phosphate;1,2,4-trichlorobenzene.
| Compound Name | chloro dihydrogen phosphate;1,2,4-trichlorobenzene |
|---|---|
| PubChem CID | 68982489 |
| Molecular Formula | C6H5Cl4O4P |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 311.87 |
| IUPAC Name | chloro dihydrogen phosphate;1,2,4-trichlorobenzene |
| SMILES | Clc1ccc(Cl)c(Cl)c1.O=P(O)(O)OCl |
| InChI | InChI=1S/C6H3Cl3.ClH2O4P/c7-4-1-2-5(8)6(9)3-4;1-5-6(2,3)4/h1-3H;(H2,2,3,4) |
| InChIKey | NGEZZZDTFJOVKR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|