C24H15Cl6O12P3 — CID 11765859
[2,4,6-tris(2,4-dichlorophenyl)-3,5-diphosphonooxyphenyl] dihydrogen phosphate (PubChem CID 11765859) has the molecular formula C24H15Cl6O12P3 and a molecular weight of 801.01 g/mol. Its IUPAC name is [2,4,6-tris(2,4-dichlorophenyl)-3,5-diphosphonooxyphenyl] dihydrogen phosphate.
| Compound Name | [2,4,6-tris(2,4-dichlorophenyl)-3,5-diphosphonooxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11765859 |
| Molecular Formula | C24H15Cl6O12P3 |
| Molecular Weight | 801.01 g/mol |
| Exact Mass | 797.79 |
| IUPAC Name | [2,4,6-tris(2,4-dichlorophenyl)-3,5-diphosphonooxyphenyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1c(-c2ccc(Cl)cc2Cl)c(OP(=O)(O)O)c(-c2ccc(Cl)cc2Cl)c(OP(=O)(O)O)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H15Cl6O12P3/c25-10-1-4-13(16(28)7-10)19-22(40-43(31,32)33)20(14-5-2-11(26)8-17(14)29)24(42-45(37,38)39)21(23(19)41-44(34,35)36)15-6-3-12(27)9-18(15)30/h1-9H,(H2,31,32,33)(H2,34,35,36)(H2,37,38,39) |
| InChIKey | FOGXAUJFLGOGLB-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.01 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|