C12H8Cl3N — CID 70539769
5-chloro-2-(2,4-dichlorophenyl)aniline (PubChem CID 70539769) has the molecular formula C12H8Cl3N and a molecular weight of 272.56 g/mol. Its IUPAC name is 5-chloro-2-(2,4-dichlorophenyl)aniline.
| Compound Name | 5-chloro-2-(2,4-dichlorophenyl)aniline |
|---|---|
| PubChem CID | 70539769 |
| Molecular Formula | C12H8Cl3N |
| Molecular Weight | 272.56 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 5-chloro-2-(2,4-dichlorophenyl)aniline |
| SMILES | Nc1cc(Cl)ccc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl3N/c13-7-1-3-9(11(15)5-7)10-4-2-8(14)6-12(10)16/h1-6H,16H2 |
| InChIKey | VQHOFHBGJMRYAN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|