C9H7ClN2S — CID 130774740
5-chloro-2-(1,3-thiazol-4-yl)aniline (PubChem CID 130774740) has the molecular formula C9H7ClN2S and a molecular weight of 210.69 g/mol. Its IUPAC name is 5-chloro-2-(1,3-thiazol-4-yl)aniline.
| Compound Name | 5-chloro-2-(1,3-thiazol-4-yl)aniline |
|---|---|
| PubChem CID | 130774740 |
| Molecular Formula | C9H7ClN2S |
| Molecular Weight | 210.69 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 5-chloro-2-(1,3-thiazol-4-yl)aniline |
| SMILES | Nc1cc(Cl)ccc1-c1cscn1 |
| InChI | InChI=1S/C9H7ClN2S/c10-6-1-2-7(8(11)3-6)9-4-13-5-12-9/h1-5H,11H2 |
| InChIKey | LNVZGKUMZCVIAZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|