C13H10ClF2N — CID 81274762
5-chloro-2-(2,5-difluoro-4-methylphenyl)aniline (PubChem CID 81274762) has the molecular formula C13H10ClF2N and a molecular weight of 253.68 g/mol. Its IUPAC name is 5-chloro-2-(2,5-difluoro-4-methylphenyl)aniline.
| Compound Name | 5-chloro-2-(2,5-difluoro-4-methylphenyl)aniline |
|---|---|
| PubChem CID | 81274762 |
| Molecular Formula | C13H10ClF2N |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 5-chloro-2-(2,5-difluoro-4-methylphenyl)aniline |
| SMILES | Cc1cc(F)c(-c2ccc(Cl)cc2N)cc1F |
| InChI | InChI=1S/C13H10ClF2N/c1-7-4-12(16)10(6-11(7)15)9-3-2-8(14)5-13(9)17/h2-6H,17H2,1H3 |
| InChIKey | DJMKTKRKDYUZJS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|