C13H10F3N — CID 82766150
5-methyl-2-(2,4,5-trifluorophenyl)aniline (PubChem CID 82766150) has the molecular formula C13H10F3N and a molecular weight of 237.22 g/mol. Its IUPAC name is 5-methyl-2-(2,4,5-trifluorophenyl)aniline.
| Compound Name | 5-methyl-2-(2,4,5-trifluorophenyl)aniline |
|---|---|
| PubChem CID | 82766150 |
| Molecular Formula | C13H10F3N |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 5-methyl-2-(2,4,5-trifluorophenyl)aniline |
| SMILES | Cc1ccc(-c2cc(F)c(F)cc2F)c(N)c1 |
| InChI | InChI=1S/C13H10F3N/c1-7-2-3-8(13(17)4-7)9-5-11(15)12(16)6-10(9)14/h2-6H,17H2,1H3 |
| InChIKey | FTCPTHLVEDKWOF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|